C27H27F4N3O5 — CID 177137053
10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;2-hydroxyacetaldehyde;trifluoromethanamine (PubChem CID 177137053) has the molecular formula C27H27F4N3O5 and a molecular weight of 549.52 g/mol. Its IUPAC name is 10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;2-hydroxyacetaldehyde;trifluoromethanamine.
| Compound Name | 10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;2-hydroxyacetaldehyde;trifluoromethanamine |
|---|---|
| PubChem CID | 177137053 |
| Molecular Formula | C27H27F4N3O5 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 10-ethyl-18-fluoro-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;2-hydroxyacetaldehyde;trifluoromethanamine |
| SMILES | CCC1C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2CCC3.NC(F)(F)F.O=CCO |
| InChI | InChI=1S/C24H21FN2O3.C2H4O2.CH2F3N/c1-3-12-15-7-20-22-16(9-27(20)23(28)17(15)10-30-24(12)29)14-6-4-5-13-11(2)18(25)8-19(26-22)21(13)14;3-1-2-4;2-1(3,4)5/h7-8,12H,3-6,9-10H2,1-2H3;1,4H,2H2;5H2 |
| InChIKey | IMAQVCCWHIYGEQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|