C9H18F3N — CID 163278789
ethane;(4S)-7,7,7-trifluorohept-1-en-4-amine (PubChem CID 163278789) has the molecular formula C9H18F3N and a molecular weight of 197.24 g/mol. Its IUPAC name is ethane;(4S)-7,7,7-trifluorohept-1-en-4-amine.
| Compound Name | ethane;(4S)-7,7,7-trifluorohept-1-en-4-amine |
|---|---|
| PubChem CID | 163278789 |
| Molecular Formula | C9H18F3N |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | ethane;(4S)-7,7,7-trifluorohept-1-en-4-amine |
| SMILES | C=CC[C@@H](N)CCC(F)(F)F.CC |
| InChI | InChI=1S/C7H12F3N.C2H6/c1-2-3-6(11)4-5-7(8,9)10;1-2/h2,6H,1,3-5,11H2;1-2H3/t6-;/m1./s1 |
| InChIKey | VEUJMUSACMKHHQ-FYZOBXCZSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|