C16H23F3N4O3 — CID 163279421
tert-butyl N-[3-[4-[2-(trifluoromethoxy)ethylamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate (PubChem CID 163279421) has the molecular formula C16H23F3N4O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-(trifluoromethoxy)ethylamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-(trifluoromethoxy)ethylamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate |
|---|---|
| PubChem CID | 163279421 |
| Molecular Formula | C16H23F3N4O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | tert-butyl N-[3-[4-[2-(trifluoromethoxy)ethylamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CC(n3cc(NCCOC(F)(F)F)cn3)(C1)C2 |
| InChI | InChI=1S/C16H23F3N4O3/c1-13(2,3)26-12(24)22-14-8-15(9-14,10-14)23-7-11(6-21-23)20-4-5-25-16(17,18)19/h6-7,20H,4-5,8-10H2,1-3H3,(H,22,24) |
| InChIKey | BZHZSRBZLRFULP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|