C26H20F5N7O4 — CID 163281038
[3-[[5-[4-(difluoromethoxy)phenyl]-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-5-(prop-2-enoylamino)phenyl] 2,2,2-trifluoroacetate (PubChem CID 163281038) has the molecular formula C26H20F5N7O4 and a molecular weight of 589.48 g/mol. Its IUPAC name is [3-[[5-[4-(difluoromethoxy)phenyl]-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-5-(prop-2-enoylamino)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[5-[4-(difluoromethoxy)phenyl]-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-5-(prop-2-enoylamino)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 163281038 |
| Molecular Formula | C26H20F5N7O4 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | [3-[[5-[4-(difluoromethoxy)phenyl]-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-5-(prop-2-enoylamino)phenyl] 2,2,2-trifluoroacetate |
| SMILES | C=CC(=O)Nc1cc(Nc2nc(Nc3cnn(C)c3)ncc2-c2ccc(OC(F)F)cc2)cc(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C26H20F5N7O4/c1-3-21(39)34-15-8-16(10-19(9-15)41-23(40)26(29,30)31)35-22-20(14-4-6-18(7-5-14)42-24(27)28)12-32-25(37-22)36-17-11-33-38(2)13-17/h3-13,24H,1H2,2H3,(H,34,39)(H2,32,35,36,37) |
| InChIKey | RRWRFOCOBTYUSX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|