C19H15N3O6 — CID 163282618
3-[5-(4-carboxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-3-yl]benzoic acid (PubChem CID 163282618) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 3-[5-(4-carboxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-3-yl]benzoic acid.
| Compound Name | 3-[5-(4-carboxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 163282618 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 3-[5-(4-carboxyphenyl)-4-[2-(hydroxyamino)-2-oxoethyl]-1H-pyrazol-3-yl]benzoic acid |
| SMILES | O=C(Cc1c(-c2cccc(C(=O)O)c2)n[nH]c1-c1ccc(C(=O)O)cc1)NO |
| InChI | InChI=1S/C19H15N3O6/c23-15(22-28)9-14-16(10-4-6-11(7-5-10)18(24)25)20-21-17(14)12-2-1-3-13(8-12)19(26)27/h1-8,28H,9H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | FTXZCFSTUWLEOS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|