C18H15N3O4 — CID 163282611
2-[3-(1,3-benzodioxol-5-yl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide (PubChem CID 163282611) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 163282611 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)-5-phenyl-1H-pyrazol-4-yl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1c(-c2ccc3c(c2)OCO3)n[nH]c1-c1ccccc1)NO |
| InChI | InChI=1S/C18H15N3O4/c22-16(21-23)9-13-17(11-4-2-1-3-5-11)19-20-18(13)12-6-7-14-15(8-12)25-10-24-14/h1-8,23H,9-10H2,(H,19,20)(H,21,22) |
| InChIKey | WBMGARYGIVKRJA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|