C11H10F2N2O2 — CID 163287190
1-(2,2-difluoroethyl)-3-methyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate (PubChem CID 163287190) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate.
| Compound Name | 1-(2,2-difluoroethyl)-3-methyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
|---|---|
| PubChem CID | 163287190 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
| SMILES | Cc1c([O-])[n+](CC(F)F)c2ccccn2c1=O |
| InChI | InChI=1S/C11H10F2N2O2/c1-7-10(16)14-5-3-2-4-9(14)15(11(7)17)6-8(12)13/h2-5,8H,6H2,1H3 |
| InChIKey | KJAGDYSTTDPVFC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|