C18H17N7O — CID 163287320
8-(2-amino-4-pyridinyl)-5-methyl-2-(6-methyl-2-pyridinyl)-7H-pteridin-6-one (PubChem CID 163287320) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 8-(2-amino-4-pyridinyl)-5-methyl-2-(6-methyl-2-pyridinyl)-7H-pteridin-6-one.
| Compound Name | 8-(2-amino-4-pyridinyl)-5-methyl-2-(6-methyl-2-pyridinyl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 163287320 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 8-(2-amino-4-pyridinyl)-5-methyl-2-(6-methyl-2-pyridinyl)-7H-pteridin-6-one |
| SMILES | Cc1cccc(-c2ncc3c(n2)N(c2ccnc(N)c2)CC(=O)N3C)n1 |
| InChI | InChI=1S/C18H17N7O/c1-11-4-3-5-13(22-11)17-21-9-14-18(23-17)25(10-16(26)24(14)2)12-6-7-20-15(19)8-12/h3-9H,10H2,1-2H3,(H2,19,20) |
| InChIKey | MSWVHEUGUOBAJI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |