C17H11N3O — CID 86166003
2-(6-methyl-2-pyridinyl)indeno[1,2-d]pyrimidin-5-one (PubChem CID 86166003) has the molecular formula C17H11N3O and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(6-methyl-2-pyridinyl)indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 2-(6-methyl-2-pyridinyl)indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 86166003 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-(6-methyl-2-pyridinyl)indeno[1,2-d]pyrimidin-5-one |
| SMILES | Cc1cccc(-c2ncc3c(n2)-c2ccccc2C3=O)n1 |
| InChI | InChI=1S/C17H11N3O/c1-10-5-4-8-14(19-10)17-18-9-13-15(20-17)11-6-2-3-7-12(11)16(13)21/h2-9H,1H3 |
| InChIKey | NCVAPCCXLJFPQC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |