C9H8N4 — CID 130153014
2-(6-methyl-2-pyridinyl)-1,3,5-triazine (PubChem CID 130153014) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-(6-methyl-2-pyridinyl)-1,3,5-triazine.
| Compound Name | 2-(6-methyl-2-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 130153014 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(6-methyl-2-pyridinyl)-1,3,5-triazine |
| SMILES | Cc1cccc(-c2ncncn2)n1 |
| InChI | InChI=1S/C9H8N4/c1-7-3-2-4-8(13-7)9-11-5-10-6-12-9/h2-6H,1H3 |
| InChIKey | BMYUYTVOZGPMSX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |