About 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper
3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper (PubChem CID 69390667) has the molecular formula C16H14ClCuN4
and a molecular weight of 361.32 g/mol. Its IUPAC name is 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper.
Molecular Properties
| Compound Name | 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper |
| PubChem CID | 69390667 |
| Molecular Formula | C16H14ClCuN4 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper |
| SMILES | Cc1cccc(-c2ccc(-c3cccc(C)n3)nn2)n1.Cl[Cu] |
| InChI | InChI=1S/C16H14N4.ClH.Cu/c1-11-5-3-7-13(17-11)15-9-10-16(20-19-15)14-8-4-6-12(2)18-14;;/h3-10H,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | BDHVSHWYLWLGBF-UHFFFAOYSA-M |
| XLogP | 3.90 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper?
The IUPAC name of 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper (CID 69390667) is 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper.
What is the SMILES notation for 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper?
The canonical SMILES for 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper is Cc1cccc(-c2ccc(-c3cccc(C)n3)nn2)n1.Cl[Cu].
What is the InChIKey of 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper?
The InChIKey is BDHVSHWYLWLGBF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H14N4.ClH.Cu/c1-11-5-3-7-13(17-11)15-9-10-16(20-19-15)14-8-4-6-12(2)18-14;;/h3-10H,1-2H3;1H;/q;;+1/p-1.
What are the key properties of 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper?
3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper has a molecular weight of 361.32 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(6-methyl-2-pyridinyl)pyridazine;chlorocopper is sourced from PubChem (CID 69390667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).