About 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine
4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine (PubChem CID 177498154) has the molecular formula C24H21N3
and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine |
| PubChem CID | 177498154 |
| Molecular Formula | C24H21N3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine |
| SMILES | Cc1ccc(-c2cc(-c3cccc(C)n3)nc(-c3cccc(C)n3)c2)cc1 |
| InChI | InChI=1S/C24H21N3/c1-16-10-12-19(13-11-16)20-14-23(21-8-4-6-17(2)25-21)27-24(15-20)22-9-5-7-18(3)26-22/h4-15H,1-3H3 |
| InChIKey | STVYRZCTISTHHB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine?
The IUPAC name of 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine (CID 177498154) is 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine.
What is the SMILES notation for 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine?
The canonical SMILES for 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine is Cc1ccc(-c2cc(-c3cccc(C)n3)nc(-c3cccc(C)n3)c2)cc1.
What is the InChIKey of 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine?
The InChIKey is STVYRZCTISTHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3/c1-16-10-12-19(13-11-16)20-14-23(21-8-4-6-17(2)25-21)27-24(15-20)22-9-5-7-18(3)26-22/h4-15H,1-3H3.
What are the key properties of 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine?
4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine has a molecular weight of 351.45 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-2,6-bis(6-methyl-2-pyridinyl)pyridine is sourced from PubChem (CID 177498154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).