C19H19N3O — CID 10709725
4-ethoxy-2,6-bis(6-methyl-2-pyridinyl)pyridine (PubChem CID 10709725) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-ethoxy-2,6-bis(6-methyl-2-pyridinyl)pyridine.
| Compound Name | 4-ethoxy-2,6-bis(6-methyl-2-pyridinyl)pyridine |
|---|---|
| PubChem CID | 10709725 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-ethoxy-2,6-bis(6-methyl-2-pyridinyl)pyridine |
| SMILES | CCOc1cc(-c2cccc(C)n2)nc(-c2cccc(C)n2)c1 |
| InChI | InChI=1S/C19H19N3O/c1-4-23-15-11-18(16-9-5-7-13(2)20-16)22-19(12-15)17-10-6-8-14(3)21-17/h5-12H,4H2,1-3H3 |
| InChIKey | WJJVSXPBKXTPFM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |