C25H34N6O4S — CID 163288639
tert-butyl N-[(1S,2S)-1-hydroxy-1-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethylamino]propan-2-yl]-N-methylcarbamate (PubChem CID 163288639) has the molecular formula C25H34N6O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-hydroxy-1-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethylamino]propan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-hydroxy-1-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethylamino]propan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163288639 |
| Molecular Formula | C25H34N6O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-hydroxy-1-[2-[2-methyl-6-[(5-phenyl-1,3-thiazol-2-yl)amino]pyrimidin-4-yl]oxyethylamino]propan-2-yl]-N-methylcarbamate |
| SMILES | Cc1nc(Nc2ncc(-c3ccccc3)s2)cc(OCCN[C@@H](O)[C@H](C)N(C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C25H34N6O4S/c1-16(31(6)24(33)35-25(3,4)5)22(32)26-12-13-34-21-14-20(28-17(2)29-21)30-23-27-15-19(36-23)18-10-8-7-9-11-18/h7-11,14-16,22,26,32H,12-13H2,1-6H3,(H,27,28,29,30)/t16-,22-/m0/s1 |
| InChIKey | QUFJJKZZOAKDNC-AOMKIAJQSA-N |
| XLogP | 4.19 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|