C14H13Cl2NO2S — CID 163288986
N-[4-chloro-2-(chloromethyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 163288986) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is N-[4-chloro-2-(chloromethyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-chloro-2-(chloromethyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 163288986 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-[4-chloro-2-(chloromethyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2CCl)cc1 |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-10-2-5-13(6-3-10)20(18,19)17-14-7-4-12(16)8-11(14)9-15/h2-8,17H,9H2,1H3 |
| InChIKey | BOQBVOOSULLDSX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|