C17H13F3N4O2 — CID 163289236
5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione (PubChem CID 163289236) has the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is 5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163289236 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-[6-(2-cyclopropylethynyl)-5-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]pyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(-c2cc([C@H]3C[C@@H]3C(F)(F)F)c(C#CC3CC3)nn2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H13F3N4O2/c18-17(19,20)12-5-9(12)10-6-14(11-7-21-16(26)22-15(11)25)24-23-13(10)4-3-8-1-2-8/h6-9,12H,1-2,5H2,(H2,21,22,25,26)/t9-,12+/m1/s1 |
| InChIKey | ZPEIVODQHQDOTL-SKDRFNHKSA-N |
| XLogP | 1.95 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|