C20H12ClN5O2 — CID 170014680
4-[(1S,2S)-2-[2-(4-chlorophenyl)ethynyl]cyclopropyl]-6-(2,4-dioxo-1H-pyrimidin-5-yl)pyridazine-3-carbonitrile (PubChem CID 170014680) has the molecular formula C20H12ClN5O2 and a molecular weight of 389.80 g/mol. Its IUPAC name is 4-[(1S,2S)-2-[2-(4-chlorophenyl)ethynyl]cyclopropyl]-6-(2,4-dioxo-1H-pyrimidin-5-yl)pyridazine-3-carbonitrile.
| Compound Name | 4-[(1S,2S)-2-[2-(4-chlorophenyl)ethynyl]cyclopropyl]-6-(2,4-dioxo-1H-pyrimidin-5-yl)pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 170014680 |
| Molecular Formula | C20H12ClN5O2 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-[(1S,2S)-2-[2-(4-chlorophenyl)ethynyl]cyclopropyl]-6-(2,4-dioxo-1H-pyrimidin-5-yl)pyridazine-3-carbonitrile |
| SMILES | N#Cc1nnc(-c2c[nH]c(=O)[nH]c2=O)cc1[C@H]1C[C@@H]1C#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12ClN5O2/c21-13-5-2-11(3-6-13)1-4-12-7-14(12)15-8-17(25-26-18(15)9-22)16-10-23-20(28)24-19(16)27/h2-3,5-6,8,10,12,14H,7H2,(H2,23,24,27,28)/t12-,14-/m0/s1 |
| InChIKey | YIWJYKLUEAZWJR-JSGCOSHPSA-N |
| XLogP | 2.20 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|