C20H20N8O5 — CID 163290687
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(methylideneamino)-5-oxopentanoic acid (PubChem CID 163290687) has the molecular formula C20H20N8O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(methylideneamino)-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(methylideneamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163290687 |
| Molecular Formula | C20H20N8O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-(methylideneamino)-5-oxopentanoic acid |
| SMILES | C=NC(=O)CC[C@H](NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C20H20N8O5/c1-22-14(29)7-6-13(19(32)33)26-17(30)10-2-4-11(5-3-10)23-8-12-9-24-16-15(25-12)18(31)28-20(21)27-16/h2-5,9,13,23H,1,6-8H2,(H,26,30)(H,32,33)(H3,21,24,27,28,31)/t13-/m0/s1 |
| InChIKey | YMNLJCHTEGEMTC-ZDUSSCGKSA-N |
| XLogP | 0.10 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|