C28H32BN3O3 — CID 163293415
5-[(3-ethenylpyrrolidin-1-yl)methyl]-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile (PubChem CID 163293415) has the molecular formula C28H32BN3O3 and a molecular weight of 469.39 g/mol. Its IUPAC name is 5-[(3-ethenylpyrrolidin-1-yl)methyl]-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile.
| Compound Name | 5-[(3-ethenylpyrrolidin-1-yl)methyl]-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile |
|---|---|
| PubChem CID | 163293415 |
| Molecular Formula | C28H32BN3O3 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 5-[(3-ethenylpyrrolidin-1-yl)methyl]-2-[2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-benzoxazole-7-carbonitrile |
| SMILES | C=CC1CCN(Cc2cc(C#N)c3oc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4C)nc3c2)C1 |
| InChI | InChI=1S/C28H32BN3O3/c1-7-19-11-12-32(16-19)17-20-13-21(15-30)25-24(14-20)31-26(33-25)22-9-8-10-23(18(22)2)29-34-27(3,4)28(5,6)35-29/h7-10,13-14,19H,1,11-12,16-17H2,2-6H3 |
| InChIKey | QGOLIOOYGKMXCV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|