C10H19F2NO — CID 163296024
3,3-difluoro-1-oxaspiro[3.5]nonan-7-amine;ethane (PubChem CID 163296024) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is 3,3-difluoro-1-oxaspiro[3.5]nonan-7-amine;ethane.
| Compound Name | 3,3-difluoro-1-oxaspiro[3.5]nonan-7-amine;ethane |
|---|---|
| PubChem CID | 163296024 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3,3-difluoro-1-oxaspiro[3.5]nonan-7-amine;ethane |
| SMILES | CC.NC1CCC2(CC1)OCC2(F)F |
| InChI | InChI=1S/C8H13F2NO.C2H6/c9-8(10)5-12-7(8)3-1-6(11)2-4-7;1-2/h6H,1-5,11H2;1-2H3 |
| InChIKey | GACFVBMLQLXLCY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |