C13H23B4N3O — CID 163296568
CID 163296568 (PubChem CID 163296568) has the molecular formula C13H23B4N3O and a molecular weight of 280.59 g/mol.
| Compound Name | CID 163296568 |
|---|---|
| PubChem CID | 163296568 |
| Molecular Formula | C13H23B4N3O |
| Molecular Weight | 280.59 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CN(CC(=O)NC(C)(C)C)CC([B])([B])C1CNC |
| InChI | InChI=1S/C13H23B4N3O/c1-11(2,3)19-10(21)6-20-7-12(14,15)9(5-18-4)13(16,17)8-20/h9,18H,5-8H2,1-4H3,(H,19,21) |
| InChIKey | VJQDUWMVSVJWRQ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.59 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|