C28H31Cl2FN4O6 — CID 163296613
(2R,3R,4S,5R,6R)-4-[4-(3-chloro-5-fluorophenyl)triazol-1-yl]-N-(3-chlorophenyl)-5-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide (PubChem CID 163296613) has the molecular formula C28H31Cl2FN4O6 and a molecular weight of 609.48 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(3-chloro-5-fluorophenyl)triazol-1-yl]-N-(3-chlorophenyl)-5-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(3-chloro-5-fluorophenyl)triazol-1-yl]-N-(3-chlorophenyl)-5-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 163296613 |
| Molecular Formula | C28H31Cl2FN4O6 |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(3-chloro-5-fluorophenyl)triazol-1-yl]-N-(3-chlorophenyl)-5-hydroxy-N-[(1S,2S)-2-hydroxycyclohexyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)cc(Cl)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1C(=O)N(c1cccc(Cl)c1)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C28H31Cl2FN4O6/c1-40-26-24(34-13-20(32-33-34)15-9-17(30)11-18(31)10-15)25(38)23(14-36)41-27(26)28(39)35(19-6-4-5-16(29)12-19)21-7-2-3-8-22(21)37/h4-6,9-13,21-27,36-38H,2-3,7-8,14H2,1H3/t21-,22-,23+,24-,25-,26+,27+/m0/s1 |
| InChIKey | AGNUIHLQCVXLIT-GYNXXCPKSA-N |
| XLogP | 3.40 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |