C30H30N4O2 — CID 163297562
N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]isoquinoline-1-carboxamide (PubChem CID 163297562) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]isoquinoline-1-carboxamide.
| Compound Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 163297562 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]isoquinoline-1-carboxamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=O)c1nccc2ccccc12)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C30H30N4O2/c1-3-19-18-34-15-12-21(19)16-27(34)28(24-11-14-31-26-9-8-22(36-2)17-25(24)26)33-30(35)29-23-7-5-4-6-20(23)10-13-32-29/h3-11,13-14,17,19,21,27-28H,1,12,15-16,18H2,2H3,(H,33,35)/t19?,21?,27?,28-/m0/s1 |
| InChIKey | VTWVIQQISBEIMG-UFBPZHMOSA-N |
| XLogP | 5.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|