C16H12F6S — CID 163297689
1,2,3,4,5-pentafluoro-6-[4-(4-fluorophenyl)sulfanylbutyl]benzene (PubChem CID 163297689) has the molecular formula C16H12F6S and a molecular weight of 350.33 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-(4-fluorophenyl)sulfanylbutyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-(4-fluorophenyl)sulfanylbutyl]benzene |
|---|---|
| PubChem CID | 163297689 |
| Molecular Formula | C16H12F6S |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-(4-fluorophenyl)sulfanylbutyl]benzene |
| SMILES | Fc1ccc(SCCCCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H12F6S/c17-9-4-6-10(7-5-9)23-8-2-1-3-11-12(18)14(20)16(22)15(21)13(11)19/h4-7H,1-3,8H2 |
| InChIKey | LSSRRFPCNQZKOQ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|