C19H22F2O5S2 — CID 163297786
[5-(benzenesulfonyl)-5,5-difluoro-3-methylpentyl] 4-methylbenzenesulfonate (PubChem CID 163297786) has the molecular formula C19H22F2O5S2 and a molecular weight of 432.51 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoro-3-methylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoro-3-methylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 163297786 |
| Molecular Formula | C19H22F2O5S2 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoro-3-methylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(C)CC(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22F2O5S2/c1-15-8-10-18(11-9-15)28(24,25)26-13-12-16(2)14-19(20,21)27(22,23)17-6-4-3-5-7-17/h3-11,16H,12-14H2,1-2H3 |
| InChIKey | ZFVJTJMAOZJFAQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|