C20H22F2O5S — CID 163297798
[5,5-difluoro-5-(4-methoxyphenyl)sulfonylpentyl] 4-methylbenzoate (PubChem CID 163297798) has the molecular formula C20H22F2O5S and a molecular weight of 412.45 g/mol. Its IUPAC name is [5,5-difluoro-5-(4-methoxyphenyl)sulfonylpentyl] 4-methylbenzoate.
| Compound Name | [5,5-difluoro-5-(4-methoxyphenyl)sulfonylpentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163297798 |
| Molecular Formula | C20H22F2O5S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [5,5-difluoro-5-(4-methoxyphenyl)sulfonylpentyl] 4-methylbenzoate |
| SMILES | COc1ccc(S(=O)(=O)C(F)(F)CCCCOC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22F2O5S/c1-15-5-7-16(8-6-15)19(23)27-14-4-3-13-20(21,22)28(24,25)18-11-9-17(26-2)10-12-18/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | RBFXAWUQQATUPL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|