C18H20N2O4S — CID 163298046
trans-methyl (1S,3S)-3-[5-(3-formylthiophen-2-yl)-3-methylpyrazin-2-yl]oxycyclohexane-1-carboxylate (PubChem CID 163298046) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is trans-methyl (1S,3S)-3-[5-(3-formylthiophen-2-yl)-3-methylpyrazin-2-yl]oxycyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,3S)-3-[5-(3-formylthiophen-2-yl)-3-methylpyrazin-2-yl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163298046 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | trans-methyl (1S,3S)-3-[5-(3-formylthiophen-2-yl)-3-methylpyrazin-2-yl]oxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@H](Oc2ncc(-c3sccc3C=O)nc2C)C1 |
| InChI | InChI=1S/C18H20N2O4S/c1-11-17(24-14-5-3-4-12(8-14)18(22)23-2)19-9-15(20-11)16-13(10-21)6-7-25-16/h6-7,9-10,12,14H,3-5,8H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | SJEQTLSUAPAHMB-JSGCOSHPSA-N |
| XLogP | 3.44 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|