C17H18N2O4S — CID 172734530
trans-(1S,3S)-3-[2-(3-formylthiophen-2-yl)-4-methylpyrimidin-5-yl]oxycyclohexane-1-carboxylic acid (PubChem CID 172734530) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is trans-(1S,3S)-3-[2-(3-formylthiophen-2-yl)-4-methylpyrimidin-5-yl]oxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,3S)-3-[2-(3-formylthiophen-2-yl)-4-methylpyrimidin-5-yl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 172734530 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | trans-(1S,3S)-3-[2-(3-formylthiophen-2-yl)-4-methylpyrimidin-5-yl]oxycyclohexane-1-carboxylic acid |
| SMILES | Cc1nc(-c2sccc2C=O)ncc1O[C@H]1CCC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C17H18N2O4S/c1-10-14(23-13-4-2-3-11(7-13)17(21)22)8-18-16(19-10)15-12(9-20)5-6-24-15/h5-6,8-9,11,13H,2-4,7H2,1H3,(H,21,22)/t11-,13-/m0/s1 |
| InChIKey | IGCRJALMJMXYRD-AAEUAGOBSA-N |
| XLogP | 3.35 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|