C24H30FN5O2 — CID 163299276
N-[4-[(2-fluoro-3-pyridinyl)methyl-(1H-indol-3-ylmethyl)amino]butyl]morpholine-4-carboxamide (PubChem CID 163299276) has the molecular formula C24H30FN5O2 and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[4-[(2-fluoro-3-pyridinyl)methyl-(1H-indol-3-ylmethyl)amino]butyl]morpholine-4-carboxamide.
| Compound Name | N-[4-[(2-fluoro-3-pyridinyl)methyl-(1H-indol-3-ylmethyl)amino]butyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 163299276 |
| Molecular Formula | C24H30FN5O2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-[4-[(2-fluoro-3-pyridinyl)methyl-(1H-indol-3-ylmethyl)amino]butyl]morpholine-4-carboxamide |
| SMILES | O=C(NCCCCN(Cc1cccnc1F)Cc1c[nH]c2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C24H30FN5O2/c25-23-19(6-5-10-26-23)17-29(18-20-16-28-22-8-2-1-7-21(20)22)11-4-3-9-27-24(31)30-12-14-32-15-13-30/h1-2,5-8,10,16,28H,3-4,9,11-15,17-18H2,(H,27,31) |
| InChIKey | KPNSYUMOVDELLJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|