C20H25FN4 — CID 167070599
N'-[(2-fluoro-4-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)pentane-1,5-diamine (PubChem CID 167070599) has the molecular formula C20H25FN4 and a molecular weight of 340.45 g/mol. Its IUPAC name is N'-[(2-fluoro-4-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)pentane-1,5-diamine.
| Compound Name | N'-[(2-fluoro-4-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 167070599 |
| Molecular Formula | C20H25FN4 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N'-[(2-fluoro-4-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)pentane-1,5-diamine |
| SMILES | NCCCCCN(Cc1ccnc(F)c1)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H25FN4/c21-20-12-16(8-10-23-20)14-25(11-5-1-4-9-22)15-17-13-24-19-7-3-2-6-18(17)19/h2-3,6-8,10,12-13,24H,1,4-5,9,11,14-15,22H2 |
| InChIKey | BUWSRHNQPYUZQG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|