C27H37FN4 — CID 167070651
N-cyclohexyl-N'-[(6-fluoro-2-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)-N-methylpentane-1,5-diamine (PubChem CID 167070651) has the molecular formula C27H37FN4 and a molecular weight of 436.62 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(6-fluoro-2-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)-N-methylpentane-1,5-diamine.
| Compound Name | N-cyclohexyl-N'-[(6-fluoro-2-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)-N-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 167070651 |
| Molecular Formula | C27H37FN4 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | N-cyclohexyl-N'-[(6-fluoro-2-pyridinyl)methyl]-N'-(1H-indol-3-ylmethyl)-N-methylpentane-1,5-diamine |
| SMILES | CN(CCCCCN(Cc1cccc(F)n1)Cc1c[nH]c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C27H37FN4/c1-31(24-12-4-2-5-13-24)17-8-3-9-18-32(21-23-11-10-16-27(28)30-23)20-22-19-29-26-15-7-6-14-25(22)26/h6-7,10-11,14-16,19,24,29H,2-5,8-9,12-13,17-18,20-21H2,1H3 |
| InChIKey | AOBAVEMCGYTJGU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|