C36H49FN4 — CID 163299374
(E)-1-N-[5-[cyclohexyl(methyl)amino]pentyl]-1-N-[(6-fluoro-2-pyridinyl)methyl]-2-(2-methylphenyl)-4-N-phenylpent-2-ene-1,4-diamine (PubChem CID 163299374) has the molecular formula C36H49FN4 and a molecular weight of 556.81 g/mol. Its IUPAC name is (E)-1-N-[5-[cyclohexyl(methyl)amino]pentyl]-1-N-[(6-fluoro-2-pyridinyl)methyl]-2-(2-methylphenyl)-4-N-phenylpent-2-ene-1,4-diamine.
| Compound Name | (E)-1-N-[5-[cyclohexyl(methyl)amino]pentyl]-1-N-[(6-fluoro-2-pyridinyl)methyl]-2-(2-methylphenyl)-4-N-phenylpent-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 163299374 |
| Molecular Formula | C36H49FN4 |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 556.39 |
| IUPAC Name | (E)-1-N-[5-[cyclohexyl(methyl)amino]pentyl]-1-N-[(6-fluoro-2-pyridinyl)methyl]-2-(2-methylphenyl)-4-N-phenylpent-2-ene-1,4-diamine |
| SMILES | Cc1ccccc1/C(=C\C(C)Nc1ccccc1)CN(CCCCCN(C)C1CCCCC1)Cc1cccc(F)n1 |
| InChI | InChI=1S/C36H49FN4/c1-29-16-11-12-22-35(29)31(26-30(2)38-32-17-7-4-8-18-32)27-41(28-33-19-15-23-36(37)39-33)25-14-6-13-24-40(3)34-20-9-5-10-21-34/h4,7-8,11-12,15-19,22-23,26,30,34,38H,5-6,9-10,13-14,20-21,24-25,27-28H2,1-3H3/b31-26- |
| InChIKey | KMOLJTWVIYIYHP-ZXPTYKNPSA-N |
| XLogP | 8.35 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|