C33H39N5O4S — CID 163299822
7-[(6-ethynyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-16-(pyridin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane (PubChem CID 163299822) has the molecular formula C33H39N5O4S and a molecular weight of 601.77 g/mol. Its IUPAC name is 7-[(6-ethynyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-16-(pyridin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane.
| Compound Name | 7-[(6-ethynyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-16-(pyridin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
|---|---|
| PubChem CID | 163299822 |
| Molecular Formula | C33H39N5O4S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 7-[(6-ethynyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-16-(pyridin-2-ylmethyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
| SMILES | C#Cc1cccc(C(c2ccc(N=C=S)cc2)N2CCOCCOCCN(Cc3ccccn3)CCOCCOCC2)n1 |
| InChI | InChI=1S/C33H39N5O4S/c1-2-29-7-5-8-32(36-29)33(28-9-11-30(12-10-28)35-27-43)38-16-20-41-24-22-39-18-14-37(26-31-6-3-4-13-34-31)15-19-40-23-25-42-21-17-38/h1,3-13,33H,14-26H2 |
| InChIKey | UXRRWWBBZMVWCZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|