C33H39N5O6S — CID 164765917
6-[[16-[(6-formyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carbaldehyde (PubChem CID 164765917) has the molecular formula C33H39N5O6S and a molecular weight of 633.77 g/mol. Its IUPAC name is 6-[[16-[(6-formyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carbaldehyde.
| Compound Name | 6-[[16-[(6-formyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 164765917 |
| Molecular Formula | C33H39N5O6S |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | 6-[[16-[(6-formyl-2-pyridinyl)-(4-isothiocyanatophenyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cccc(CN2CCOCCOCCN(C(c3ccc(N=C=S)cc3)c3cccc(C=O)n3)CCOCCOCC2)n1 |
| InChI | InChI=1S/C33H39N5O6S/c39-24-30-4-1-3-29(35-30)23-37-11-15-41-19-21-43-17-13-38(14-18-44-22-20-42-16-12-37)33(32-6-2-5-31(25-40)36-32)27-7-9-28(10-8-27)34-26-45/h1-10,24-25,33H,11-23H2 |
| InChIKey | KOTJTFJFSUSUSW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 115.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|