C30H36N4O7 — CID 166147375
6-[[14-[(6-formyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosa-1(22),18,20-trien-5-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 166147375) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is 6-[[14-[(6-formyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosa-1(22),18,20-trien-5-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[14-[(6-formyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosa-1(22),18,20-trien-5-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166147375 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 6-[[14-[(6-formyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosa-1(22),18,20-trien-5-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=Cc1cccc(CN2CCOCCOCCN(Cc3cccc(C(=O)O)n3)CCOc3ccccc3OCC2)n1 |
| InChI | InChI=1S/C30H36N4O7/c35-23-26-7-3-5-24(31-26)21-33-11-15-38-19-20-39-16-12-34(22-25-6-4-8-27(32-25)30(36)37)14-18-41-29-10-2-1-9-28(29)40-17-13-33/h1-10,23H,11-22H2,(H,36,37) |
| InChIKey | LSILZBMOOFRTDB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|