C38H36F8N4O8 — CID 174155356
6-[[16-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-3,4-bis(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxylic acid (PubChem CID 174155356) has the molecular formula C38H36F8N4O8 and a molecular weight of 828.71 g/mol. Its IUPAC name is 6-[[16-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-3,4-bis(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-[[16-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-3,4-bis(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 174155356 |
| Molecular Formula | C38H36F8N4O8 |
| Molecular Weight | 828.71 g/mol |
| Exact Mass | 828.24 |
| IUPAC Name | 6-[[16-[(6-carboxy-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]-3,4-bis(2,3,5,6-tetrafluorophenyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2CCOCCOCCN(Cc3cc(-c4c(F)c(F)cc(F)c4F)c(-c4c(F)c(F)cc(F)c4F)c(C(=O)O)n3)CCOCCOCC2)n1 |
| InChI | InChI=1S/C38H36F8N4O8/c39-24-17-25(40)33(44)30(32(24)43)23-16-22(48-36(38(53)54)29(23)31-34(45)26(41)18-27(42)35(31)46)20-50-6-10-57-14-12-55-8-4-49(5-9-56-13-15-58-11-7-50)19-21-2-1-3-28(47-21)37(51)52/h1-3,16-18H,4-15,19-20H2,(H,51,52)(H,53,54) |
| InChIKey | KEEISKSAHQMHOU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|