C29H42N4O6 — CID 155638397
6-[[(1R,18R)-14-(pyridin-2-ylmethyl)-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 155638397) has the molecular formula C29H42N4O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is 6-[[(1R,18R)-14-(pyridin-2-ylmethyl)-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[[(1R,18R)-14-(pyridin-2-ylmethyl)-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155638397 |
| Molecular Formula | C29H42N4O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 6-[[(1R,18R)-14-(pyridin-2-ylmethyl)-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2CCOCCOCCN(Cc3ccccn3)CCO[C@@H]3CCCC[C@H]3OCC2)n1 |
| InChI | InChI=1S/C29H42N4O6/c34-29(35)26-8-5-7-25(31-26)23-33-13-17-37-21-20-36-16-12-32(22-24-6-3-4-11-30-24)14-18-38-27-9-1-2-10-28(27)39-19-15-33/h3-8,11,27-28H,1-2,9-10,12-23H2,(H,34,35)/t27-,28-/m1/s1 |
| InChIKey | IHUIMVPPNKJMGH-VSGBNLITSA-N |
| XLogP | 2.87 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |