C40H62N4O8 — CID 164598822
6-[[14-[(6-carboxy-2-pyridinyl)methyl]-20,20-dimethyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid;ethane;(2Z,4Z)-hexa-2,4-diene (PubChem CID 164598822) has the molecular formula C40H62N4O8 and a molecular weight of 726.96 g/mol. Its IUPAC name is 6-[[14-[(6-carboxy-2-pyridinyl)methyl]-20,20-dimethyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid;ethane;(2Z,4Z)-hexa-2,4-diene.
| Compound Name | 6-[[14-[(6-carboxy-2-pyridinyl)methyl]-20,20-dimethyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid;ethane;(2Z,4Z)-hexa-2,4-diene |
|---|---|
| PubChem CID | 164598822 |
| Molecular Formula | C40H62N4O8 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.46 |
| IUPAC Name | 6-[[14-[(6-carboxy-2-pyridinyl)methyl]-20,20-dimethyl-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.4.0]docosan-5-yl]methyl]pyridine-2-carboxylic acid;ethane;(2Z,4Z)-hexa-2,4-diene |
| SMILES | C/C=C\C=C/C.CC.CC1(C)CCC2OCCN(Cc3cccc(C(=O)O)n3)CCOCCOCCN(Cc3cccc(C(=O)O)n3)CCOC2C1 |
| InChI | InChI=1S/C32H46N4O8.C6H10.C2H6/c1-32(2)10-9-28-29(21-32)44-18-14-36(23-25-6-4-8-27(34-25)31(39)40)12-16-42-20-19-41-15-11-35(13-17-43-28)22-24-5-3-7-26(33-24)30(37)38;1-3-5-6-4-2;1-2/h3-8,28-29H,9-23H2,1-2H3,(H,37,38)(H,39,40);3-6H,1-2H3;1-2H3/b;5-3-,6-4-; |
| InChIKey | YOOLWQPTNZLJBC-DOUHFRIOSA-N |
| XLogP | 6.37 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|