C31H44N4O8 — CID 155283747
methyl 6-[[(1S,18R)-14-[(6-methoxycarbonyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosan-5-yl]methyl]pyridine-2-carboxylate (PubChem CID 155283747) has the molecular formula C31H44N4O8 and a molecular weight of 600.71 g/mol. Its IUPAC name is methyl 6-[[(1S,18R)-14-[(6-methoxycarbonyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosan-5-yl]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[(1S,18R)-14-[(6-methoxycarbonyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosan-5-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 155283747 |
| Molecular Formula | C31H44N4O8 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | methyl 6-[[(1S,18R)-14-[(6-methoxycarbonyl-2-pyridinyl)methyl]-2,8,11,17-tetraoxa-5,14-diazabicyclo[16.3.0]henicosan-5-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(CN2CCOCCOCCN(Cc3cccc(C(=O)OC)n3)CCO[C@@H]3CCC[C@@H]3OCC2)n1 |
| InChI | InChI=1S/C31H44N4O8/c1-38-30(36)26-8-3-6-24(32-26)22-34-12-16-40-20-21-41-17-13-35(23-25-7-4-9-27(33-25)31(37)39-2)15-19-43-29-11-5-10-28(29)42-18-14-34/h3-4,6-9,28-29H,5,10-23H2,1-2H3/t28-,29+ |
| InChIKey | QTMFTRGOARRNAG-ISILISOKSA-N |
| XLogP | 2.36 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |