C37H54N6O11 — CID 169106842
N-(2-aminoperoxyethyl)formamide;formic acid;6-[(4-methylphenyl)-[16-[(6-methyl-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 169106842) has the molecular formula C37H54N6O11 and a molecular weight of 758.87 g/mol. Its IUPAC name is N-(2-aminoperoxyethyl)formamide;formic acid;6-[(4-methylphenyl)-[16-[(6-methyl-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid.
| Compound Name | N-(2-aminoperoxyethyl)formamide;formic acid;6-[(4-methylphenyl)-[16-[(6-methyl-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169106842 |
| Molecular Formula | C37H54N6O11 |
| Molecular Weight | 758.87 g/mol |
| Exact Mass | 758.39 |
| IUPAC Name | N-(2-aminoperoxyethyl)formamide;formic acid;6-[(4-methylphenyl)-[16-[(6-methyl-2-pyridinyl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(C(c2cccc(C(=O)O)n2)N2CCOCCOCCN(Cc3cccc(C)n3)CCOCCOCC2)cc1.NOOCCNC=O.O=CO |
| InChI | InChI=1S/C33H44N4O6.C3H8N2O3.CH2O2/c1-26-9-11-28(12-10-26)32(30-7-4-8-31(35-30)33(38)39)37-15-19-42-23-21-40-17-13-36(14-18-41-22-24-43-20-16-37)25-29-6-3-5-27(2)34-29;4-8-7-2-1-5-3-6;2-1-3/h3-12,32H,13-25H2,1-2H3,(H,38,39);3H,1-2,4H2,(H,5,6);1H,(H,2,3) |
| InChIKey | VTTHAMCMGHGSKN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 217.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.87 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|