C31H46N5O9SW- — CID 163299852
6-[[16-[1-(2H-pyridin-2-id-6-yl)-2-[2-(2-thiocyanatoethoxy)ethoxy]ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid;tungsten;hydrate (PubChem CID 163299852) has the molecular formula C31H46N5O9SW- and a molecular weight of 848.64 g/mol. Its IUPAC name is 6-[[16-[1-(2H-pyridin-2-id-6-yl)-2-[2-(2-thiocyanatoethoxy)ethoxy]ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid;tungsten;hydrate.
| Compound Name | 6-[[16-[1-(2H-pyridin-2-id-6-yl)-2-[2-(2-thiocyanatoethoxy)ethoxy]ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid;tungsten;hydrate |
|---|---|
| PubChem CID | 163299852 |
| Molecular Formula | C31H46N5O9SW- |
| Molecular Weight | 848.64 g/mol |
| Exact Mass | 848.25 |
| IUPAC Name | 6-[[16-[1-(2H-pyridin-2-id-6-yl)-2-[2-(2-thiocyanatoethoxy)ethoxy]ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylic acid;tungsten;hydrate |
| SMILES | N#CSCCOCCOCC(c1ccc[c-]n1)N1CCOCCOCCN(Cc2cccc(C(=O)O)n2)CCOCCOCC1.O.[W] |
| InChI | InChI=1S/C31H44N5O8S.H2O.W/c32-26-45-23-22-43-20-21-44-25-30(28-5-1-2-7-33-28)36-10-14-41-18-16-39-12-8-35(9-13-40-17-19-42-15-11-36)24-27-4-3-6-29(34-27)31(37)38;;/h1-6,30H,8-25H2,(H,37,38);1H2;/q-1;; |
| InChIKey | KFOQKBLXXGPYHD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 180.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.64 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|