C20H23NOS — CID 163300865
1-phenyl-2-[(2S)-2-[(1R)-1-phenyl-1-sulfanylethyl]pyrrolidin-1-yl]ethanone (PubChem CID 163300865) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-phenyl-2-[(2S)-2-[(1R)-1-phenyl-1-sulfanylethyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-phenyl-2-[(2S)-2-[(1R)-1-phenyl-1-sulfanylethyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 163300865 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-phenyl-2-[(2S)-2-[(1R)-1-phenyl-1-sulfanylethyl]pyrrolidin-1-yl]ethanone |
| SMILES | C[C@@](S)(c1ccccc1)[C@@H]1CCCN1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NOS/c1-20(23,17-11-6-3-7-12-17)19-13-8-14-21(19)15-18(22)16-9-4-2-5-10-16/h2-7,9-12,19,23H,8,13-15H2,1H3/t19-,20+/m0/s1 |
| InChIKey | QROFDUZKUYRZES-VQTJNVASSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|