C27H26N2O4 — CID 139629640
(2S)-N-(2-hydroxy-2,2-diphenylacetyl)-1-phenacylpyrrolidine-2-carboxamide (PubChem CID 139629640) has the molecular formula C27H26N2O4 and a molecular weight of 442.51 g/mol. Its IUPAC name is (2S)-N-(2-hydroxy-2,2-diphenylacetyl)-1-phenacylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2-hydroxy-2,2-diphenylacetyl)-1-phenacylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139629640 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2S)-N-(2-hydroxy-2,2-diphenylacetyl)-1-phenacylpyrrolidine-2-carboxamide |
| SMILES | O=C(CN1CCC[C@H]1C(=O)NC(=O)C(O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c30-24(20-11-4-1-5-12-20)19-29-18-10-17-23(29)25(31)28-26(32)27(33,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23,33H,10,17-19H2,(H,28,31,32)/t23-/m0/s1 |
| InChIKey | VRKWRBDDCDOZSK-QHCPKHFHSA-N |
| XLogP | 2.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |