C26H26N2O3 — CID 67619591
(2S)-N-benzyl-1-[2-oxo-2-(3-phenoxyphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 67619591) has the molecular formula C26H26N2O3 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S)-N-benzyl-1-[2-oxo-2-(3-phenoxyphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-benzyl-1-[2-oxo-2-(3-phenoxyphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67619591 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2S)-N-benzyl-1-[2-oxo-2-(3-phenoxyphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(CN1CCC[C@H]1C(=O)NCc1ccccc1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H26N2O3/c29-25(21-11-7-14-23(17-21)31-22-12-5-2-6-13-22)19-28-16-8-15-24(28)26(30)27-18-20-9-3-1-4-10-20/h1-7,9-14,17,24H,8,15-16,18-19H2,(H,27,30)/t24-/m0/s1 |
| InChIKey | JQZHJYPSUQKJMO-DEOSSOPVSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |