C20H20N2O5 — CID 67620122
(2R)-N-benzoyl-1-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 67620122) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2R)-N-benzoyl-1-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-benzoyl-1-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67620122 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2R)-N-benzoyl-1-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(CN1CCC[C@@H]1C(=O)NC(=O)c1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H20N2O5/c23-16-9-8-14(11-17(16)24)18(25)12-22-10-4-7-15(22)20(27)21-19(26)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,15,23-24H,4,7,10,12H2,(H,21,26,27)/t15-/m1/s1 |
| InChIKey | QFMLYHBNJDEZNA-OAHLLOKOSA-N |
| XLogP | 1.70 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|