C26H31N3O5 — CID 22878877
(2-morpholin-4-yl-1-phenylethyl) 2-[(2S)-2-(benzoylcarbamoyl)pyrrolidin-1-yl]acetate (PubChem CID 22878877) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is (2-morpholin-4-yl-1-phenylethyl) 2-[(2S)-2-(benzoylcarbamoyl)pyrrolidin-1-yl]acetate.
| Compound Name | (2-morpholin-4-yl-1-phenylethyl) 2-[(2S)-2-(benzoylcarbamoyl)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 22878877 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (2-morpholin-4-yl-1-phenylethyl) 2-[(2S)-2-(benzoylcarbamoyl)pyrrolidin-1-yl]acetate |
| SMILES | O=C(CN1CCC[C@H]1C(=O)NC(=O)c1ccccc1)OC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3O5/c30-24(34-23(20-8-3-1-4-9-20)18-28-14-16-33-17-15-28)19-29-13-7-12-22(29)26(32)27-25(31)21-10-5-2-6-11-21/h1-6,8-11,22-23H,7,12-19H2,(H,27,31,32)/t22-,23?/m0/s1 |
| InChIKey | GIHSXIKDJLVKQL-NQCNTLBGSA-N |
| XLogP | 2.02 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|