C23H26N2O6 — CID 22878879
(2S)-N-benzoyl-1-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 22878879) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is (2S)-N-benzoyl-1-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-benzoyl-1-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22878879 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (2S)-N-benzoyl-1-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)CN2CCC[C@H]2C(=O)NC(=O)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C23H26N2O6/c1-29-19-12-11-16(20(30-2)21(19)31-3)18(26)14-25-13-7-10-17(25)23(28)24-22(27)15-8-5-4-6-9-15/h4-6,8-9,11-12,17H,7,10,13-14H2,1-3H3,(H,24,27,28)/t17-/m0/s1 |
| InChIKey | ZIIPPULGWYSNHN-KRWDZBQOSA-N |
| XLogP | 2.32 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|