C26H29ClN2O3 — CID 67619747
(2R)-N-benzoyl-1-[2-[1-(4-chlorophenyl)cyclohexyl]-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 67619747) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is (2R)-N-benzoyl-1-[2-[1-(4-chlorophenyl)cyclohexyl]-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-benzoyl-1-[2-[1-(4-chlorophenyl)cyclohexyl]-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67619747 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (2R)-N-benzoyl-1-[2-[1-(4-chlorophenyl)cyclohexyl]-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NC(=O)[C@H]1CCCN1CC(=O)C1(c2ccc(Cl)cc2)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN2O3/c27-21-13-11-20(12-14-21)26(15-5-2-6-16-26)23(30)18-29-17-7-10-22(29)25(32)28-24(31)19-8-3-1-4-9-19/h1,3-4,8-9,11-14,22H,2,5-7,10,15-18H2,(H,28,31,32)/t22-/m1/s1 |
| InChIKey | OJULASLBGNTVBP-JOCHJYFZSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|