C16H16F2N6 — CID 163302540
9-(2,6-difluorophenyl)-12-methyl-4,5,8,10,14-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-amine (PubChem CID 163302540) has the molecular formula C16H16F2N6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 9-(2,6-difluorophenyl)-12-methyl-4,5,8,10,14-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-amine.
| Compound Name | 9-(2,6-difluorophenyl)-12-methyl-4,5,8,10,14-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-amine |
|---|---|
| PubChem CID | 163302540 |
| Molecular Formula | C16H16F2N6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 9-(2,6-difluorophenyl)-12-methyl-4,5,8,10,14-pentazatricyclo[8.4.0.03,7]tetradeca-1,3(7),5,8-tetraen-14-amine |
| SMILES | CC1CN(N)C2=Cc3[nH]ncc3N=C(c3c(F)cccc3F)N2C1 |
| InChI | InChI=1S/C16H16F2N6/c1-9-7-23-14(24(19)8-9)5-12-13(6-20-22-12)21-16(23)15-10(17)3-2-4-11(15)18/h2-6,9H,7-8,19H2,1H3,(H,20,22) |
| InChIKey | MWIDPKCLRWPQDI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|