C18H13F2N7 — CID 163302578
2,4-difluoro-3-(5-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2,5,7,14-pentaen-8-yl)benzonitrile (PubChem CID 163302578) has the molecular formula C18H13F2N7 and a molecular weight of 365.35 g/mol. Its IUPAC name is 2,4-difluoro-3-(5-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2,5,7,14-pentaen-8-yl)benzonitrile.
| Compound Name | 2,4-difluoro-3-(5-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2,5,7,14-pentaen-8-yl)benzonitrile |
|---|---|
| PubChem CID | 163302578 |
| Molecular Formula | C18H13F2N7 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2,4-difluoro-3-(5-methyl-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2,5,7,14-pentaen-8-yl)benzonitrile |
| SMILES | Cc1[nH]nc2c1N=C(c1c(F)ccc(C#N)c1F)N1CCCn3ncc-2c31 |
| InChI | InChI=1S/C18H13F2N7/c1-9-15-16(25-24-9)11-8-22-27-6-2-5-26(18(11)27)17(23-15)13-12(19)4-3-10(7-21)14(13)20/h3-4,8H,2,5-6H2,1H3,(H,24,25) |
| InChIKey | QBKFYZVHTOFFQQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |